TITRASI ASAM-BASA

  • Published on
    16-Jul-2015

  • View
    803

  • Download
    3

Embed Size (px)

Transcript

<p>1 Tujuan: Menentukan kadarasam/basa yang secara kimiawi tepat ekivalen dengan jumlah basa/asam yang ada Keadaan/saat tepat ekivalen antara jumlah asam dan jumlah basa disebut titik-ekivalen (TE), titik stoikiometri, atau titik akhir teoritis Titik akhir titrasi (TAT) suatu keadaan dimana titrasi harus dihentikan, tepat terjadi perubahan warna larutan,kelebihan sedikit larutan titran. TE dan TAT harus sangat sedikit perbedaannya agar kesalahan titrasisekecil mungkin ( Pemilihan indikator yang sesuai ) </p> <p> Titrasi Asam-Basa-MJH2 AsamBasapH ekivalenGaram (G) kuatkuat 7Netral lemahkuat&gt; 7Terhidolisis kuatlemah&lt; 7Terhidrolisis lemahlemahTergantung pKa dan pKb Terhidrolisis 3 Asidimetri: titrasi larutan basa oleh larutan standar asam Alkalimetri: titrasi larutan asam oleh larutan standar basa Selama titrasi terjadi perubahan pH sedikit demi sedikitGaram dari basa lemah dengan asam kuat pH = (pKw pKb log G) Garam dari asam lemah dengan basa kuat pH = (pKw + pKa + log G)Indikatorasam - basa Indikator asam basa : ialah zat yang berubah (berbeda) warnanya dalam suasana asam dan suasana basa . Contoh : pp, mo, dsb Perubahan warna tidak terjadi secara drastis, melainkan terjadi secara perlahan-lahan, sesuai dengan terjadinya perubahan pH dalam larutan. Perubahan pH larutan yang menyebabkan terjadinya perubahan warna indikator disebut daerah (interval) pH yang biasanya terletak antara dua satuan pH.4 5 Menurut W. Ostwald Semua indikator yang umumnya digunakan adalah asam-asam atau basa-basa organik sangat lemah yang berubah warnanya dengan terjadinya perubahan pH larutan. Asam indikator yang tidak berdisosiasi (HIn) atau basa indikator yang tidak berdisosiasi (InOH) mempunyai warna yang berbeda dari warna ionnya Kesetimbanganindikator dalam larutan air '''(1)(1 )+ -- -HIwarna dwanarnH InInOnatakterionisasi terionisaH OH Insi++6 + -HInH In+7 Indikator asam lemah Dalam larutan asam, jumlah H+ berlebih kesetimbangan akan bergeser ke kiri (jumlah In- sangat kecil) warna indikator dalam larutan akan sesuai dengan warna indikator dalam bentuk tak-terionisasi (HIn) Dalam suasana basa, jumlah H+ sangat sedikitkesetimbangan akan bergeser ke kanan (jmlah In- sangat banyak) warna indikator dalam larutan akan sesuai dengan warna indikator dalam bentuk terionisasi (In-) | || |(2)(3)-H IninHIn++ --in+ -H InH InHIn HInHInHInHH InInBentuk yang takterion HInBentuk yang tedanrion H Inina ay yKa yyKy yyKy y++ + (( = = ( = ( =| |'(3 )+in-HInBentukyangtakterionHBentukyang terionIninK K( = = ( 8 Menurut hukum aksi-massa: Kin: Tetapan ionisasi indikator , y : koefisienkeaktifan Untuk larutan yang sangat encery = 1, maka Persamaan (3) diringkas menjadi bentuk konsentrasi: | |log (4)-InpH p inHInK ( = +| |(5)+InOHOH inInK ( = ( (6)+ -++wInHinInOKarena w H OHHKKK ( ( = ( (( = 9 Warna sesungguhnya dari indikator tergantung pada angka banding [In-]/[HIn] yang barkaitan dengan [H+] Untuk indikator basa lemah 10 Teori Oswald tentang perubahan warnaindikator perlu disempurnakan , akan tetapi prinsip dasar persamaan perubahankimiamejadi dasar pengembanga berikutnya. Menurut Hantzsch Perubahan warna indikator tidak hanya disebabkan oleh perubahan warna antara bentuk molekul dan bentuk ionnya, tetapi juga disebabkan oleh perubahan struktur, termasuk menghasilkan bentuk kuinoid dan resonansi, misalnya pada indikator fenolftalein (pp). -O OHOHCCOOOHOHCCOO-OHCOCOO-CCOO-OO-OH-OH-CCOO-OO-OH[I][II] [III][IV]OH berlebihMerah Tidak berwarnaTidak berwarnaTidak berwarna11 Perubahan struktur dan warna indikator Fenolftalein Jingga metil ( m o )SOO-O N N NCH3CH3SOO-O NHN NCH3CH3+12 Jingga kuning OH- (7)(8)++InAHInInAIn In A H+ BKa aa=Titrasi Asam-Basa-MJH13 Konsep Bronsted Tidak perlu dibedakan antara indikator asam dan basa, yang ditekankan adalah jenis muatan dari bentuk asam dan bentuk basa dari indikator. Kesetimbangan antara bentuk asam InA dan bentuk basa InB dapat dinyatakan sebagai: (9)log log (10)AA BIn A BB B +HInA AInInIn InIn InpH=-logpIn InyK yya Kya ( = ( (( = + + (( Titrasi Asam-Basa-MJH14 Warna indikator yang dapat diamati oleh mata, ditetapkan sebagai angka banding dari [InA]/[InB] pH akan tergantung pada kuat ion larutan (yang berkaitan dengan koefisien keaktifan). 'InBpH=p In + log (11)InAKTitrasi Asam-Basa-MJH15 Keseimbangan perubahan warna pada setiap kuat ion tertentu dapat dinyatakan dengan persamaan yang dimodifikasi. pKIn adalah tetapan indikator nampak Nilai angka banding [InB] / [InA] (yaitu [bentuk basa] / [bentuk asam] tergantung pada [H+] (pH) larutan dapat ditetapkan dengan perbandingan warna secara visual (tampak oleh mata), atau lebih tepat lagi dengan metoda spektrofotometri. ''warnaasamterlihat pada pH=p In 1warna basa terlihat pada pH=p In 1+KK16 Namun demikian,(dalam pelaksanaantitrasi), mata manusia mempunyai kemampuan yang terbatas untuk mendeteksi salah satu dari dua warna apabila salah satunya adalah dominan. Menurut pengalaman: larutan akan nampak memiliki warna asam (InA), apabila rasio [InA]/[InB] &gt; 10 larutan akan nampak memiliki warna basa (InB), apabila rasio [InB]/[InA] &gt; 10Sehingga batas pH yang bersangkutan (dari persamaan 11) adalah: 'pH= p In 1 K17 Jadi, selang perubahan warna (kisaran indikator) adalah Kira-kira dua satuan pH Selama titrasi, secara berangsur-angsur terjadi perubahan pH yang mengakibatkan terjadinya perubahan warna, yangbergantung pada angka banding [InA] dan [InB] Apabila pH larutan = pKIn, angka banding [InA]/[InB] = 1 warna larutan adalah (jika intensitas wrnanya sama kuat) warna campuran antara bentuk asam dan bentuk basa rona tengah dari indikator Jika bentuk yang satu lebih kuat intensitas warnanya dibandingkan dengan yang lain, maka rona-tengah akan bergesr sepanjang jangkau indikator itu 18 Indikatorkisaran pH Warna dalam larutan asam Warna dalam larutan basa pKIn Kuning metil2,9 4,0MerahKuning3,3 Jingga metil3,2 4,4MerahJingga3,7 Merah metil4,2 6,3MerahKuning5,0 Biru bromotimol 6,0 7,6KuningBiru7,1 Fenoftalein8,310,0Tak berwarnaMerah9,6 Timolftalein8,310,5Tak berwarnaBiru9,3 Perubahan warna dan kisaran pH beberapa indikator19 Hal yang perlu diperhatikan dalam analisis kuantitatif asam-basa: Keasaman dari air yang digunakan, baik untuk pembuatan larutan standar maupun untuk pelarut. Air dalam kesetimbangan dengan tekanan normal mengandung 0,03% volume CO2, pH-nya = 5,7.Air suling pH=7, air jenuh CO2 (1 atm,25C), pH=3,7 Indikator fenolftalein adalah satu-satunya indikator yang sangat baik, karena selain perubahan warnanya cukup jelas, juga hanya sedikit dipengaruhi oleh CO2 Titrasi Asam-Basa-MJH20 Contoh perubahan warna indikator padapH 0-14Pembagian Indikator Indikator21 Indikator tunggal Indikator campuran Indikator tunggal berwarna satu Hanya menunjukkan satu warna saja pada pH tertentu Misal: fenolftalein (pp) Indikator tunggal berwarna dua Dalam larutan yang bersifat asam dan basa memberikan dua warna yang berbeda Misal: merah metil (mm) Titrasi Asam-Basa-MJH22 Penyiapan indikator Biasanya larutan indikator untuk persediaan mengandung 0,5-1 g indikator/L pelarut (etanol ,air, dsb.)Merah metilLarutkan 1 g asam bebasnya dalam 1 L air panas atau larutkan dalam 600 mL etanol dan encerkan dengan 400 mL air. Fenolftalein (pp) Larutkan 5 g pp dalam 500 mL etanol dan tambahkan 500 mL air dengan terus diaduk. Saring jika terbentuk endapan Jingga metilLarutkan 0,5 g asam bebasnya dalam 1 L air, saring. Larutkan 0,5 g garam natriumnya dalam 1 L air + 15,2 mL HCl 0,1 M, saring. Campuran indikatorpHPerubahan warna Komposisi Hijau bromokresol;jingga metil 4,3JinggaHijau biru 1 bagian 0,1% (Na) dalam air, 1 bagian0,2% dalam air Hijau bromokresol; Merah klorofenol 6,1Hijau pucat ungu biru 1 bagian 0,1% (Na) dalam air,1 bagian0,1% dalam air Biru bromotimol; Merah netral 7,2Merah muda hijau 1 bagian 0,1% dalam etanol,1 bagian0,1% dalam etanol Biru bromotimol; Merah fenol 7,5Kuning ungu1 bagian 0,1% (Na) dalam air,1 bagian0,1% (Na) dalam air Biru timol; Merah kresol 8,3Kuning ungu3bagian 0,1% (Na) dalam air,1 bagian0,1% (Na) dalam air Biru timol;Fenolftalein 9,0Kuning ungu1 bagian 0,1% dalam 50% etanol,3 bagian 0,1% dalam 50% etanol Timolftalein; fenolftalein 9,9Tak berwarna ungu 1 bagian 0,1%dalam etanol,1 bagian0,1% dalam air Titrasi Asam-Basa-MJH24 Beberapa contoh indikator campuran Titrasi Asam-Basa-MJH25 Indikator Universal Dengan mencampur indikator-indikator tertentu yang sesuai, perubahan warna dapat timbul pada sebagian besar daerah pH Indikator UNIVERSAL tersedia secara komersial sebagai larutan dan sebagai kertas uji Contoh 1. Bogen (1927). Larutan 0,1 g fenolftalein; 0,2 g merah metil; 0,3 g kuning metil; 0,4 g biru bromotimol; dan 0,5 g biru timol dalam 500 mL etanol absolut, tambahkan larutan natrium hidroksida sampai warna menjadi kuning. Perubahan warna: pH 2, merah; pH 4, jingga; pH 6, kuning; pH 8, hijau, pH 10, biru. 2. T.B. Smith (1929). Larutan 0,05 g jingga metil; 0,15 g merah metil; 0,3 g biru bromotimol, dan 0,35 g fenolftalein dalam 1 L etanol 66%. Perubahan warna: pH s 3 merah; pH 4, merah jingga; pH 5, jingga; pH 6, kuning; pH 7, hijau-kekuningan; pH 8, biru-kehijauan; pH 9, biru; pH 10, violet, pH 11, violet-kemerahan Kurva penetralan [G]pH=pKa+log[A][G]pH = pKw - pKb - log[B]26 Mengetahui perubahan pH larutan selama berlangsungnya titrasi Mengetahui besarnya pH larutan di sekitar titik ekivalen Menentukan / memilih indikator yang sesuai 1. Larutan bufer dari asam lemah dan garamnya 2. Larutan bufer dari basa lemah dan garamnya Back 27 3. Larutan garam terhidrolisis dari asam lemah dan basa kuat pH = (pKw+pKa+log [G]) 4. Larutan garam terhidrolisis dari basa lemah dan asam kuat pH = (pKw-pKb-log [G]) 5. Larutan garam terhidolisis dari asam lemah dan basa lemah pH = (pKw + pKa - pKb) 28 Pedoman pembuatan kurva netralisasi Tentukan besarnya pH larutan: 1. mula-mula, sebelum dititrasi 2. pada setiap penambahan volume pereaksi (standar, titran)sampai sebelum titik ekivalen tercapai, 3. pada saat tercapainya titik ekivalen, 4. pada saat kelebihan pereaksi (titran) 29 Contoh: titrasi netralisasi 100 mL HCl1 M dengan NaOH 1 M pH mula-mula, sebelum dititrasi [HCl] = 1 M [H+] = 1 M pH = - log [H+] = - log 1 = 0 Jadi pH larutan mula-mula = 0 pH pada setiap penambahan volume pereaksi (titran)sampai sebelum titik ekivalen tercapai, Penambahan NaOH 10 mL HCl semula = 100 mL x 1 M = 100 mmol NaOH yg ditambahkan = 1o mL x 1 M =10 mmol Dari reaksi:HCl+NaOH NaCl+H2O Semula 10010 0 Bereaksi101010 (hasil)( NETRAL ) HCl sisa 90 mmol/110 mL [H+] = 9/11 mol/L pH = - log 9/11 = 0,0877Jadi pH larutan adalah = 0,088 30 Penambahan NaOH 25 m NaOH = 25 mL x 1 M = 25 mmolHCl sisa (100-25)=75 mmol/125 mL [H+] = 75/125 mol/L pH = - log 3/5= 0,2219 Jadi pH larutan adalah 0,222 Dst .. Penambahan NaOH 90mL HCl sisa (100-90)=10mmol/190 mL [H+] = 10/190 mol/L pH = - log 1/19 = 1,2788 Jadi pH larutan adalah 1,279 Dst pH larutan pada saat tercapainya titik ekivalenvolume NaOH 100 mL HCl dan NaOH habis bereaksi, Terbentuk NaCl: NETRAL; pH larutan ( camp) = 7 Titrasi Asam-Basa-MJH31 pH larutan pada saat kelebihan pereaksi (titran) Penambahan NaOH 101 mL (Kelebihan NaOH 1 mL ) ; Vol tot = 201 mL HCl= 100 mL x 1 M = 100 mmol NaOH = 101 mL x 1 M = 101 mmolReaksi: ( seperti yang tertulis ) NaOH sisa = 101-100 = 1 mmol/201 mL [NaOH]sisa = 1/201 mol/L [OH-]=1/201 mol/LpOH = - log [OH-]= - log 1/201 = 2,3032 pH = 14 2,3032 = 11,697 Penambahan NaOH 150 mL (Kelebihan 50 mL) NaOH sisa = (150-100) = 50 mmol/250 mL [NaOH]sisa = 50/250 mol/L [OH-]=50/250 mol/LpOH = - log [OH-]= - log 50/250 = 0,6990 pH = 14 0,6990 = 13,301 Dst 024681012140 25 50 75 100 125 150 175 200NaOH yang ditambahkan (mL)pH1 M0.1 M0.01 MKonsentrasi (M) pH 13-10,5 0,14,5-9,5 0,015,5-8,5Titrasi Asam-Basa-MJH32 Kurva-kurva penetralan 100 mL HCl dengan NaOH yang sama konsentrasinya Titik ekivalen Konsentrasi (M)Indikator dengan kisaran pH Kesalahan 13-10,5Kecil. Dapat diabaikan 0,14,5-9,5 Jingga metil, fenolftalein 0,2 % dapat diabaikan 0,015,5-8,5merah metil, biru bromtimol 1-2 % jingga metil Titrasi Asam-Basa-MJH33 +pH = -logKa.[H ]34 Kurva netralisasi asam lemah-basa kuat Hal-hal yang perlu diperhatikan a. Pada setiap penambahan larutan pereaksi (titran) sebelum titik ekivalen : tersisa asam lemahlarutan bufer asam pH = pKa + log [G]/[A][A] sisa (mmol) b. Pada TE: pH garam (hidrolisis) pH = ( pKw + pKa + log [G] ) [G] = mol/L ( M ) Contoh: Titrasi 100 mL CH3COOH 0,1 M (Ka = 1. 0-5) dengan larutan basa kuat NaOH 0,1 MpH mula-mula, sebelum dititrasi CH3COOH3 H+ CH3COO- Kurva netralisasi basa kuat-asam kuat 35 36 pH =- log (1 . 10-5 x 0,1)1/2= 3 pH pada setiap penambahan volume pereaksi (titran)sampai sebelum titik ekivalen tercapai Penambahan NaOH 10 mL CH3COOH semula = 100 mL x0,1 M = 10 mmolNaOH yg ditambahkan = 10 mL x0,1 M = 1 mmol ReaksiCH3COOH+NaOHCH3COONa+H2O Semula101 0 Bereaksi11 1 mmol ( hasil ) Sisa9 mmol 0 1 mmolSIST BUFER pH = pKa + log [G]/[A] = 5 + log [1]/[9] = 4 Penambahan NaOH 25 mL [G] = 2,5/125 mol/L dan [A]sisa = 7,5/125 mol/L pH = 4,7399 + log 2,5/7,5 = 4,2628Titrasi Asam-Basa-MJH37 Penambahan NaOH 50 mL pH 5 Penambahan NaOH 75 mL pH 5,37 Penambahan NaOH 90 mL pH 5,85 pH larutan pada saat tercapainya titik ekivalen volume NaOH 0,1 M =100 mL Reaksi : seperti yang tertulisCH3COONa yang terbentuk =10 mmol/200 mL[G] = 0,05mol/L pH = (pKw + pKa + log [G]) = (14 + 5 + log 0,05) = 8,85 pH larutan pada setiap kelebihan pereaksi Kelebihan 1 mL (penambahan NaOH 101 mL): vol tot = 201 mL CH3COOH= 100 mL x 0,1 M = 10 mmol NaOH = 102 mL x 0,1 M = 10,1 mmol NaOH sisa (10,1-10)= 0,1 mmol/201 mL= 0,1 / 201 M</p> <p>[OH-] = 0,1/201 mol/L pOH = -log [OH-]= -log 0,1/201 = 3,3 Jadi pH larutan adalah 14 3,3 = 10,7 38 Kelebihan 10 mL (penambahan NaOH 110 mL) NaOH sisa (11-10) = 1 mmol/210 mL; [OH-]sisa=1/210 mmol/L pOH = -log 1/210 = 2,3 pH = 14 - 2,3 = 11,7 Dst .. 39 024681012140 25 50 75 100 125150175 200225Volume NaOH (mL)pH40 Kurva penetralan100 mL CH3COOH 0,1 M dengan NaOH 0,1 M TE Indikator yang dapat digunakan (6,7 10,6) Fenolftalein8,3 10 Timolfalein 8,3 10,5 Timol biru 8 9,6 41 Untuk asam lemah dengan Ka &lt; 10-7, kelajuan perubahan pH di sekitar titik ekivalen tidak cukup jelas, sehingga jika digunakan indikator tunggal perubahan warnanya tidak jelas dibutuhkan indikator campuran Kurva netralisasi basa kuat-asam lemah 0246810120 25 50 75 100125150175200225Volume HCl 0,1 MpHIndikatorJangkau pH Jingga metil3,0 - 4,5 Merah metil4,2 6,3 Bromo fenol biru3,0 -4,6 42 Kurva penetralan100 mL NH4OH 0,1 M (Kb = 1,8 10-5) dengan HCl 0,1 M TE 5,278 Indikator daerah pHnya sedikit asam 3 7,2 0123456789100 25 50 75 100125 150 175 200 225Volume NH4OH (mL)pH43 Kurva penetralan100 mL CH3COOH 0,1 M dengan NH4OH 0,1 M pKa = pKb = 4,74 pH titik ekivalen 7 Daerah perubahan pH sangat sempit, indikator tunggal tidak memberikan perubahan warna yang jelas 44 Kurva netralisasi basa lemah-asam lemah Titrasi Asam-Basa-MJH45 Titrasi Asam-Basa-MJH46 Cont...</p>